C28H29N3O6S — CID 6298284
ethyl 2-[(4E)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(4-pentoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 6298284) has the molecular formula C28H29N3O6S and a molecular weight of 535.62 g/mol. Its IUPAC name is ethyl 2-[(4E)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(4-pentoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(4E)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(4-pentoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6298284 |
| Molecular Formula | C28H29N3O6S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | ethyl 2-[(4E)-4-[hydroxy(pyridin-4-yl)methylidene]-2,3-dioxo-5-(4-pentoxyphenyl)pyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3ccncc3)C(=O)C(=O)N2c2nc(C)c(C(=O)OCC)s2)cc1 |
| InChI | InChI=1S/C28H29N3O6S/c1-4-6-7-16-37-20-10-8-18(9-11-20)22-21(23(32)19-12-14-29-15-13-19)24(33)26(34)31(22)28-30-17(3)25(38-28)27(35)36-5-2/h8-15,22,32H,4-7,16H2,1-3H3/b23-21+ |
| InChIKey | JNLPLRBVCUQPIR-XTQSDGFTSA-N |
| XLogP | 5.22 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|