C27H26N2O8S — CID 94482137
ethyl 2-[(2S)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 94482137) has the molecular formula C27H26N2O8S and a molecular weight of 538.58 g/mol. Its IUPAC name is ethyl 2-[(2S)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2S)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 94482137 |
| Molecular Formula | C27H26N2O8S |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | ethyl 2-[(2S)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2-(4-hydroxy-3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OC)c(C)c3)[C@@H]2c2ccc(O)c(OC)c2)nc1C |
| InChI | InChI=1S/C27H26N2O8S/c1-6-37-26(34)24-14(3)28-27(38-24)29-21(15-7-9-17(30)19(12-15)36-5)20(23(32)25(29)33)22(31)16-8-10-18(35-4)13(2)11-16/h7-12,21,30-31H,6H2,1-5H3/t21-/m0/s1 |
| InChIKey | WHDKIRGJAJBMOP-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|