C24H19ClN2O5S — CID 3571820
1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 3571820) has the molecular formula C24H19ClN2O5S and a molecular weight of 482.95 g/mol. Its IUPAC name is 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3571820 |
| Molecular Formula | C24H19ClN2O5S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(c3nc(C)c(C(C)=O)s3)C2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H19ClN2O5S/c1-12-22(13(2)28)33-24(26-12)27-19(14-4-8-16(25)9-5-14)18(21(30)23(27)31)20(29)15-6-10-17(32-3)11-7-15/h4-11,19,29H,1-3H3 |
| InChIKey | QPYTYNDECXEACJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|