C26H24N2O7S — CID 34063639
(5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 34063639) has the molecular formula C26H24N2O7S and a molecular weight of 508.55 g/mol. Its IUPAC name is (5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 34063639 |
| Molecular Formula | C26H24N2O7S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (5S)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@H]2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2c2nc(C)c(C(C)=O)s2)ccc1O |
| InChI | InChI=1S/C26H24N2O7S/c1-5-35-19-12-16(8-11-18(19)30)21-20(22(31)15-6-9-17(34-4)10-7-15)23(32)25(33)28(21)26-27-13(2)24(36-26)14(3)29/h6-12,21,30-31H,5H2,1-4H3/t21-/m0/s1 |
| InChIKey | ROQYLWWIUFATEP-NRFANRHFSA-N |
| XLogP | 4.39 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|