C26H21FN2O5S — CID 6228964
(4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6228964) has the molecular formula C26H21FN2O5S and a molecular weight of 492.53 g/mol. Its IUPAC name is (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6228964 |
| Molecular Formula | C26H21FN2O5S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc4c(c3)CC(C)O4)C2c2ccccc2F)nc1C |
| InChI | InChI=1S/C26H21FN2O5S/c1-12-10-16-11-15(8-9-19(16)34-12)22(31)20-21(17-6-4-5-7-18(17)27)29(25(33)23(20)32)26-28-13(2)24(35-26)14(3)30/h4-9,11-12,21,31H,10H2,1-3H3/b22-20+ |
| InChIKey | IKPBHCPOTILEIW-LSDHQDQOSA-N |
| XLogP | 4.74 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|