C29H23FN2O4S — CID 41034702
(5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 41034702) has the molecular formula C29H23FN2O4S and a molecular weight of 514.58 g/mol. Its IUPAC name is (5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41034702 |
| Molecular Formula | C29H23FN2O4S |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (5R)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | Cc1cc(C)c2nc(N3C(=O)C(=O)C(=C(O)c4ccc5c(c4)C[C@H](C)O5)[C@@H]3c3ccccc3F)sc2c1 |
| InChI | InChI=1S/C29H23FN2O4S/c1-14-10-15(2)24-22(11-14)37-29(31-24)32-25(19-6-4-5-7-20(19)30)23(27(34)28(32)35)26(33)17-8-9-21-18(13-17)12-16(3)36-21/h4-11,13,16,25,33H,12H2,1-3H3/t16-,25-/m0/s1 |
| InChIKey | WOTDXPVZNGCLAU-LMKMVOKYSA-N |
| XLogP | 6.00 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|