C32H30N2O6S — CID 45128637
acetic acid;(4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 45128637) has the molecular formula C32H30N2O6S and a molecular weight of 570.67 g/mol. Its IUPAC name is acetic acid;(4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | acetic acid;(4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 45128637 |
| Molecular Formula | C32H30N2O6S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | acetic acid;(4E)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CC(=O)O.Cc1ccc(C2/C(=C(\O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1 |
| InChI | InChI=1S/C30H26N2O4S.C2H4O2/c1-15-5-7-19(8-6-15)26-24(27(33)20-9-10-22-21(14-20)13-18(4)36-22)28(34)29(35)32(26)30-31-25-17(3)11-16(2)12-23(25)37-30;1-2(3)4/h5-12,14,18,26,33H,13H2,1-4H3;1H3,(H,3,4)/b27-24+; |
| InChIKey | QWAMZIZRRPTPAK-KYYAMWDPSA-N |
| XLogP | 6.26 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|