C31H28N2O6S — CID 98326243
(4E,5S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 98326243) has the molecular formula C31H28N2O6S and a molecular weight of 556.64 g/mol. Its IUPAC name is (4E,5S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98326243 |
| Molecular Formula | C31H28N2O6S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | (4E,5S)-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-hydroxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)ccc1O |
| InChI | InChI=1S/C31H28N2O6S/c1-5-38-23-14-18(6-8-21(23)34)27-25(28(35)19-7-9-22-20(13-19)12-17(4)39-22)29(36)30(37)33(27)31-32-26-16(3)10-15(2)11-24(26)40-31/h6-11,13-14,17,27,34-35H,5,12H2,1-4H3/b28-25+/t17-,27-/m0/s1 |
| InChIKey | LRFZTOTWTQMKBZ-TUKIDQFVSA-N |
| XLogP | 5.97 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|