C33H28N2O6S — CID 6238595
(4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6238595) has the molecular formula C33H28N2O6S and a molecular weight of 580.66 g/mol. Its IUPAC name is (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6238595 |
| Molecular Formula | C33H28N2O6S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (4E)-1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc4c(c3)CC(C)O4)C2c2cccc(OCc3ccccc3)c2)nc1C |
| InChI | InChI=1S/C33H28N2O6S/c1-18-14-24-15-23(12-13-26(24)41-18)29(37)27-28(22-10-7-11-25(16-22)40-17-21-8-5-4-6-9-21)35(32(39)30(27)38)33-34-19(2)31(42-33)20(3)36/h4-13,15-16,18,28,37H,14,17H2,1-3H3/b29-27+ |
| InChIKey | QXCQUOWGXDSOLV-ORIPQNMZSA-N |
| XLogP | 6.18 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|