C36H30N2O6S — CID 98381666
(4E,5S)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98381666) has the molecular formula C36H30N2O6S and a molecular weight of 618.71 g/mol. Its IUPAC name is (4E,5S)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98381666 |
| Molecular Formula | C36H30N2O6S |
| Molecular Weight | 618.71 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | (4E,5S)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc5c(c4)C[C@H](C)O5)[C@@H]3c3cccc(OCc4ccccc4)c3)sc2c1 |
| InChI | InChI=1S/C36H30N2O6S/c1-3-42-27-13-14-28-30(19-27)45-36(37-28)38-32(23-10-7-11-26(18-23)43-20-22-8-5-4-6-9-22)31(34(40)35(38)41)33(39)24-12-15-29-25(17-24)16-21(2)44-29/h4-15,17-19,21,32,39H,3,16,20H2,1-2H3/b33-31+/t21-,32-/m0/s1 |
| InChIKey | LPJCGBSAWPYSKM-MDLGLMBTSA-N |
| XLogP | 7.22 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.71 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|