C37H32N2O7S — CID 6172948
(4E)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 6172948) has the molecular formula C37H32N2O7S and a molecular weight of 648.74 g/mol. Its IUPAC name is (4E)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6172948 |
| Molecular Formula | C37H32N2O7S |
| Molecular Weight | 648.74 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | (4E)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2c2nc3ccc(OC)cc3s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H32N2O7S/c1-4-44-30-18-23(10-15-29(30)45-20-22-8-6-5-7-9-22)33-32(34(40)24-11-14-28-25(17-24)16-21(2)46-28)35(41)36(42)39(33)37-38-27-13-12-26(43-3)19-31(27)47-37/h5-15,17-19,21,33,40H,4,16,20H2,1-3H3/b34-32+ |
| InChIKey | HVHKVIAFIOCFPO-NWBJSICCSA-N |
| XLogP | 7.23 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|