C36H29FN2O6S — CID 99668140
(4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 99668140) has the molecular formula C36H29FN2O6S and a molecular weight of 636.70 g/mol. Its IUPAC name is (4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 99668140 |
| Molecular Formula | C36H29FN2O6S |
| Molecular Weight | 636.70 g/mol |
| Exact Mass | 636.17 |
| IUPAC Name | (4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2c2nc3ccc(F)cc3s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H29FN2O6S/c1-3-43-29-17-22(9-14-28(29)44-19-21-7-5-4-6-8-21)32-31(33(40)23-10-13-27-24(16-23)15-20(2)45-27)34(41)35(42)39(32)36-38-26-12-11-25(37)18-30(26)46-36/h4-14,16-18,20,32,40H,3,15,19H2,1-2H3/b33-31+/t20-,32+/m0/s1 |
| InChIKey | GSOBFAFMGBUVGA-XRDGOKTRSA-N |
| XLogP | 7.36 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|