C31H27FN2O6S — CID 98339385
(4E,5R)-5-(3,4-diethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 98339385) has the molecular formula C31H27FN2O6S and a molecular weight of 574.63 g/mol. Its IUPAC name is (4E,5R)-5-(3,4-diethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(3,4-diethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98339385 |
| Molecular Formula | C31H27FN2O6S |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | (4E,5R)-5-(3,4-diethoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc([C@@H]2/C(=C(\O)c3ccc4c(c3)C[C@@H](C)O4)C(=O)C(=O)N2c2nc3ccc(F)cc3s2)cc1OCC |
| InChI | InChI=1S/C31H27FN2O6S/c1-4-38-23-11-6-17(14-24(23)39-5-2)27-26(28(35)18-7-10-22-19(13-18)12-16(3)40-22)29(36)30(37)34(27)31-33-21-9-8-20(32)15-25(21)41-31/h6-11,13-16,27,35H,4-5,12H2,1-3H3/b28-26+/t16-,27-/m1/s1 |
| InChIKey | AVHYVSJRHSXRKN-BGLRTBKGSA-N |
| XLogP | 6.18 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|