C34H32N2O7S — CID 45128619
(4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 45128619) has the molecular formula C34H32N2O7S and a molecular weight of 612.70 g/mol. Its IUPAC name is (4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 45128619 |
| Molecular Formula | C34H32N2O7S |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | (4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2/C(=C(/O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2c2nc3ccc(OCC)cc3s2)cc1OCC |
| InChI | InChI=1S/C34H32N2O7S/c1-5-14-42-26-13-8-20(17-27(26)41-7-3)30-29(31(37)21-9-12-25-22(16-21)15-19(4)43-25)32(38)33(39)36(30)34-35-24-11-10-23(40-6-2)18-28(24)44-34/h5,8-13,16-19,30,37H,1,6-7,14-15H2,2-4H3/b31-29- |
| InChIKey | UYDCIPAVGVGJBP-YCNYHXFESA-N |
| XLogP | 6.61 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|