C32H30N2O8S — CID 6222378
(4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6222378) has the molecular formula C32H30N2O8S and a molecular weight of 602.67 g/mol. Its IUPAC name is (4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6222378 |
| Molecular Formula | C32H30N2O8S |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | (4E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc5c(c4)CC(C)O5)C3c3cc(OC)c(OC)c(OC)c3)sc2c1 |
| InChI | InChI=1S/C32H30N2O8S/c1-6-41-20-8-9-21-25(15-20)43-32(33-21)34-27(19-13-23(38-3)30(40-5)24(14-19)39-4)26(29(36)31(34)37)28(35)17-7-10-22-18(12-17)11-16(2)42-22/h7-10,12-16,27,35H,6,11H2,1-5H3/b28-26+ |
| InChIKey | IHNBFGHVAILJJJ-BYCLXTJYSA-N |
| XLogP | 5.67 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|