C31H26N2O7S — CID 98379687
methyl 4-[(2S,3E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 98379687) has the molecular formula C31H26N2O7S and a molecular weight of 570.62 g/mol. Its IUPAC name is methyl 4-[(2S,3E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S,3E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 98379687 |
| Molecular Formula | C31H26N2O7S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | methyl 4-[(2S,3E)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc5c(c4)C[C@H](C)O5)[C@@H]3c3ccc(C(=O)OC)cc3)sc2c1 |
| InChI | InChI=1S/C31H26N2O7S/c1-4-39-21-10-11-22-24(15-21)41-31(32-22)33-26(17-5-7-18(8-6-17)30(37)38-3)25(28(35)29(33)36)27(34)19-9-12-23-20(14-19)13-16(2)40-23/h5-12,14-16,26,34H,4,13H2,1-3H3/b27-25+/t16-,26-/m0/s1 |
| InChIKey | LVUDUIBMLLOXQG-RFAFYKRUSA-N |
| XLogP | 5.43 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|