C29H23N3O7S — CID 45128780
(4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 45128780) has the molecular formula C29H23N3O7S and a molecular weight of 557.58 g/mol. Its IUPAC name is (4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 45128780 |
| Molecular Formula | C29H23N3O7S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | (4Z)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C(=O)/C(=C(\O)c4ccc5c(c4)CC(C)O5)C3c3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C29H23N3O7S/c1-3-38-20-9-10-21-23(14-20)40-29(30-21)31-25(16-4-7-19(8-5-16)32(36)37)24(27(34)28(31)35)26(33)17-6-11-22-18(13-17)12-15(2)39-22/h4-11,13-15,25,33H,3,12H2,1-2H3/b26-24- |
| InChIKey | HZBMRQDECDMLNG-LCUIJRPUSA-N |
| XLogP | 5.55 |
| TPSA | 132.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|