C29H21FN2O6S — CID 4585093
methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 4585093) has the molecular formula C29H21FN2O6S and a molecular weight of 544.56 g/mol. Its IUPAC name is methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 4585093 |
| Molecular Formula | C29H21FN2O6S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | methyl 4-[1-(6-fluoro-1,3-benzothiazol-2-yl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C29H21FN2O6S/c1-14-11-18-12-17(7-10-21(18)38-14)25(33)23-24(15-3-5-16(6-4-15)28(36)37-2)32(27(35)26(23)34)29-31-20-9-8-19(30)13-22(20)39-29/h3-10,12-14,24,33H,11H2,1-2H3 |
| InChIKey | YXHABXSFOQDFLG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|