C30H24N2O6S — CID 98376821
methyl 4-[(2R,3E)-3-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 98376821) has the molecular formula C30H24N2O6S and a molecular weight of 540.60 g/mol. Its IUPAC name is methyl 4-[(2R,3E)-3-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,3E)-3-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 98376821 |
| Molecular Formula | C30H24N2O6S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | methyl 4-[(2R,3E)-3-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2/C(=C(\O)c3ccc4c(c3)C[C@@H](C)O4)C(=O)C(=O)N2c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C30H24N2O6S/c1-15-4-10-21-23(12-15)39-30(31-21)32-25(17-5-7-18(8-6-17)29(36)37-3)24(27(34)28(32)35)26(33)19-9-11-22-20(14-19)13-16(2)38-22/h4-12,14,16,25,33H,13H2,1-3H3/b26-24+/t16-,25-/m1/s1 |
| InChIKey | DINGZXPGZDTWAZ-QNIVJUIWSA-N |
| XLogP | 5.34 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|