C33H23FN2O5S — CID 45132769
(4Z)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 45132769) has the molecular formula C33H23FN2O5S and a molecular weight of 578.62 g/mol. Its IUPAC name is (4Z)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 45132769 |
| Molecular Formula | C33H23FN2O5S |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | (4Z)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CC1Cc2cc(/C(O)=C3/C(=O)C(=O)N(c4nc5ccc(F)cc5s4)C3c3cccc(Oc4ccccc4)c3)ccc2O1 |
| InChI | InChI=1S/C33H23FN2O5S/c1-18-14-21-15-20(10-13-26(21)40-18)30(37)28-29(19-6-5-9-24(16-19)41-23-7-3-2-4-8-23)36(32(39)31(28)38)33-35-25-12-11-22(34)17-27(25)42-33/h2-13,15-18,29,37H,14H2,1H3/b30-28- |
| InChIKey | JNLZAFHFFATULK-HYOGKJQXSA-N |
| XLogP | 7.18 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|