C34H25FN2O5S — CID 94483913
(5R)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 94483913) has the molecular formula C34H25FN2O5S and a molecular weight of 592.65 g/mol. Its IUPAC name is (5R)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 94483913 |
| Molecular Formula | C34H25FN2O5S |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | (5R)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | C[C@H]1Cc2cc(C(O)=C3C(=O)C(=O)N(c4nc5ccc(F)cc5s4)[C@@H]3c3cccc(OCc4ccccc4)c3)ccc2O1 |
| InChI | InChI=1S/C34H25FN2O5S/c1-19-14-23-15-22(10-13-27(23)42-19)31(38)29-30(21-8-5-9-25(16-21)41-18-20-6-3-2-4-7-20)37(33(40)32(29)39)34-36-26-12-11-24(35)17-28(26)43-34/h2-13,15-17,19,30,38H,14,18H2,1H3/t19-,30+/m0/s1 |
| InChIKey | MVXYYBMZRJUPNX-WWOZWPLTSA-N |
| XLogP | 6.96 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|