C25H16N2O6S2 — CID 108722801
2-[(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 108722801) has the molecular formula C25H16N2O6S2 and a molecular weight of 504.55 g/mol. Its IUPAC name is 2-[(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 108722801 |
| Molecular Formula | C25H16N2O6S2 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 2-[(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C1C(=O)N(c2nc3ccc(C(=O)O)cc3s2)C(c2cccs2)/C1=C(\O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C25H16N2O6S2/c28-21(13-4-6-16-12(10-13)7-8-33-16)19-20(17-2-1-9-34-17)27(23(30)22(19)29)25-26-15-5-3-14(24(31)32)11-18(15)35-25/h1-6,9-11,20,28H,7-8H2,(H,31,32)/b21-19+ |
| InChIKey | NOLCIEAJSVUBBU-XUTLUUPISA-N |
| XLogP | 4.62 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|