C25H18N2O7S2 — CID 108722757
2-[(4E)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 108722757) has the molecular formula C25H18N2O7S2 and a molecular weight of 522.56 g/mol. Its IUPAC name is 2-[(4E)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(4E)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 108722757 |
| Molecular Formula | C25H18N2O7S2 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-[(4E)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-thiophen-2-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(=O)O)cc4s3)C2c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C25H18N2O7S2/c1-33-13-6-7-14(16(11-13)34-2)21(28)19-20(17-4-3-9-35-17)27(23(30)22(19)29)25-26-15-8-5-12(24(31)32)10-18(15)36-25/h3-11,20,28H,1-2H3,(H,31,32)/b21-19+ |
| InChIKey | ZKACJQISRFTRDQ-XUTLUUPISA-N |
| XLogP | 4.70 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|