C25H16ClN3O6S — CID 108724852
2-[(4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 108724852) has the molecular formula C25H16ClN3O6S and a molecular weight of 521.94 g/mol. Its IUPAC name is 2-[(4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 108724852 |
| Molecular Formula | C25H16ClN3O6S |
| Molecular Weight | 521.94 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 2-[(4E)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | COc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(=O)O)cc4s3)C2c2cccnc2)c1 |
| InChI | InChI=1S/C25H16ClN3O6S/c1-35-14-5-6-16(26)15(10-14)21(30)19-20(13-3-2-8-27-11-13)29(23(32)22(19)31)25-28-17-7-4-12(24(33)34)9-18(17)36-25/h2-11,20,30H,1H3,(H,33,34)/b21-19+ |
| InChIKey | ULTKOLIRILOOEL-XUTLUUPISA-N |
| XLogP | 4.68 |
| TPSA | 129.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.94 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|