C24H14BrN3O5S — CID 108724834
2-[(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 108724834) has the molecular formula C24H14BrN3O5S and a molecular weight of 536.36 g/mol. Its IUPAC name is 2-[(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 108724834 |
| Molecular Formula | C24H14BrN3O5S |
| Molecular Weight | 536.36 g/mol |
| Exact Mass | 534.98 |
| IUPAC Name | 2-[(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C1C(=O)N(c2nc3ccc(C(=O)O)cc3s2)C(c2cccnc2)/C1=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H14BrN3O5S/c25-15-6-3-12(4-7-15)20(29)18-19(14-2-1-9-26-11-14)28(22(31)21(18)30)24-27-16-8-5-13(23(32)33)10-17(16)34-24/h1-11,19,29H,(H,32,33)/b20-18+ |
| InChIKey | ZLCKABCCUIJYAH-CZIZESTLSA-N |
| XLogP | 4.78 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|