C26H19N3O6S — CID 108724863
2-[(4E)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 108724863) has the molecular formula C26H19N3O6S and a molecular weight of 501.52 g/mol. Its IUPAC name is 2-[(4E)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(4E)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 108724863 |
| Molecular Formula | C26H19N3O6S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 2-[(4E)-4-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(=O)O)cc4s3)C2c2cccnc2)cc1C |
| InChI | InChI=1S/C26H19N3O6S/c1-13-10-14(6-8-18(13)35-2)22(30)20-21(16-4-3-9-27-12-16)29(24(32)23(20)31)26-28-17-7-5-15(25(33)34)11-19(17)36-26/h3-12,21,30H,1-2H3,(H,33,34)/b22-20+ |
| InChIKey | ODICQZPAGIDXHI-LSDHQDQOSA-N |
| XLogP | 4.33 |
| TPSA | 129.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|