C25H16BrN3O5S — CID 108724805
2-[(4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 108724805) has the molecular formula C25H16BrN3O5S and a molecular weight of 550.39 g/mol. Its IUPAC name is 2-[(4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[(4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 108724805 |
| Molecular Formula | C25H16BrN3O5S |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 549.00 |
| IUPAC Name | 2-[(4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-3-ylpyrrolidin-1-yl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(=O)O)cc4s3)C2c2cccnc2)ccc1Br |
| InChI | InChI=1S/C25H16BrN3O5S/c1-12-9-13(4-6-16(12)26)21(30)19-20(15-3-2-8-27-11-15)29(23(32)22(19)31)25-28-17-7-5-14(24(33)34)10-18(17)35-25/h2-11,20,30H,1H3,(H,33,34)/b21-19+ |
| InChIKey | KEYOGXNJYJKNQR-XUTLUUPISA-N |
| XLogP | 5.09 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|