C23H12ClF2N3O3S — CID 108724599
(4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108724599) has the molecular formula C23H12ClF2N3O3S and a molecular weight of 483.88 g/mol. Its IUPAC name is (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108724599 |
| Molecular Formula | C23H12ClF2N3O3S |
| Molecular Weight | 483.88 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[(4-fluorophenyl)-hydroxymethylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3cc(Cl)c(F)cc3s2)C(c2cccnc2)/C1=C(\O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H12ClF2N3O3S/c24-14-8-16-17(9-15(14)26)33-23(28-16)29-19(12-2-1-7-27-10-12)18(21(31)22(29)32)20(30)11-3-5-13(25)6-4-11/h1-10,19,30H/b20-18+ |
| InChIKey | YYFKBKAAZUBURP-CZIZESTLSA-N |
| XLogP | 5.25 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.88 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|