C24H12Cl3FN2O3S — CID 4711274
1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 4711274) has the molecular formula C24H12Cl3FN2O3S and a molecular weight of 533.80 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4711274 |
| Molecular Formula | C24H12Cl3FN2O3S |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc(Cl)cc3s2)C(c2ccc(Cl)c(Cl)c2)C1=C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H12Cl3FN2O3S/c25-13-4-8-17-18(10-13)34-24(29-17)30-20(12-3-7-15(26)16(27)9-12)19(22(32)23(30)33)21(31)11-1-5-14(28)6-2-11/h1-10,20,31H |
| InChIKey | OSZHQSCABOUUHQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|