C24H14ClFN2O3S — CID 17038295
(4Z)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 17038295) has the molecular formula C24H14ClFN2O3S and a molecular weight of 464.91 g/mol. Its IUPAC name is (4Z)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 17038295 |
| Molecular Formula | C24H14ClFN2O3S |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | (4Z)-1-(1,3-benzothiazol-2-yl)-4-[(4-chlorophenyl)-hydroxymethylidene]-5-(4-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccccc3s2)C(c2ccc(F)cc2)/C1=C(/O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H14ClFN2O3S/c25-15-9-5-14(6-10-15)21(29)19-20(13-7-11-16(26)12-8-13)28(23(31)22(19)30)24-27-17-3-1-2-4-18(17)32-24/h1-12,20,29H/b21-19- |
| InChIKey | HOOPXAOXDINLRV-VZCXRCSSSA-N |
| XLogP | 5.72 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|