C25H15Cl3N2O4S — CID 6119280
(4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6119280) has the molecular formula C25H15Cl3N2O4S and a molecular weight of 545.83 g/mol. Its IUPAC name is (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6119280 |
| Molecular Formula | C25H15Cl3N2O4S |
| Molecular Weight | 545.83 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | (4E)-1-(6-chloro-1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(Cl)cc4s3)C2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H15Cl3N2O4S/c1-34-15-6-2-12(3-7-15)22(31)20-21(13-4-8-16(27)17(28)10-13)30(24(33)23(20)32)25-29-18-9-5-14(26)11-19(18)35-25/h2-11,21,31H,1H3/b22-20+ |
| InChIKey | CBSUULYFGYDIDH-LSDHQDQOSA-N |
| XLogP | 6.89 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.83 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|