C24H15ClFN3O4S — CID 108724614
(4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108724614) has the molecular formula C24H15ClFN3O4S and a molecular weight of 495.92 g/mol. Its IUPAC name is (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108724614 |
| Molecular Formula | C24H15ClFN3O4S |
| Molecular Weight | 495.92 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | (4E)-1-(5-chloro-6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methoxyphenyl)methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4cc(Cl)c(F)cc4s3)C2c2cccnc2)cc1 |
| InChI | InChI=1S/C24H15ClFN3O4S/c1-33-14-6-4-12(5-7-14)21(30)19-20(13-3-2-8-27-11-13)29(23(32)22(19)31)24-28-17-9-15(25)16(26)10-18(17)34-24/h2-11,20,30H,1H3/b21-19+ |
| InChIKey | OSLQHRMBULZMRD-XUTLUUPISA-N |
| XLogP | 5.12 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|