C29H24N2O4S — CID 108715010
(4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108715010) has the molecular formula C29H24N2O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108715010 |
| Molecular Formula | C29H24N2O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | (4E)-4-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc5c(c4)CCO5)C3c3cccc(C)c3)sc2c1 |
| InChI | InChI=1S/C29H24N2O4S/c1-3-17-7-9-21-23(14-17)36-29(30-21)31-25(19-6-4-5-16(2)13-19)24(27(33)28(31)34)26(32)20-8-10-22-18(15-20)11-12-35-22/h4-10,13-15,25,32H,3,11-12H2,1-2H3/b26-24+ |
| InChIKey | GYKZRMCJJGQRBB-SHHOIMCASA-N |
| XLogP | 5.73 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|