C27H22N2O3S — CID 40859375
(5S)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 40859375) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is (5S)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 40859375 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (5S)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc2nc(N3C(=O)C(=O)C(=C(O)c4ccccc4)[C@@H]3c3ccc(C)cc3)sc2c1 |
| InChI | InChI=1S/C27H22N2O3S/c1-3-17-11-14-20-21(15-17)33-27(28-20)29-23(18-12-9-16(2)10-13-18)22(25(31)26(29)32)24(30)19-7-5-4-6-8-19/h4-15,23,30H,3H2,1-2H3/t23-/m0/s1 |
| InChIKey | LIATUZKSIFHMTM-QHCPKHFHSA-N |
| XLogP | 5.79 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|