C26H19BrN2O3S — CID 98347249
(4E,5S)-5-(4-bromophenyl)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 98347249) has the molecular formula C26H19BrN2O3S and a molecular weight of 519.42 g/mol. Its IUPAC name is (4E,5S)-5-(4-bromophenyl)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(4-bromophenyl)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98347249 |
| Molecular Formula | C26H19BrN2O3S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | (4E,5S)-5-(4-bromophenyl)-1-(6-ethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccccc4)[C@@H]3c3ccc(Br)cc3)sc2c1 |
| InChI | InChI=1S/C26H19BrN2O3S/c1-2-15-8-13-19-20(14-15)33-26(28-19)29-22(16-9-11-18(27)12-10-16)21(24(31)25(29)32)23(30)17-6-4-3-5-7-17/h3-14,22,30H,2H2,1H3/b23-21+/t22-/m0/s1 |
| InChIKey | ZFULHIDTPGZWOL-MOBKVPTQSA-N |
| XLogP | 6.25 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|