C24H14BrClN2O3S — CID 98379133
(4E,5R)-1-(6-bromo-1,3-benzothiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 98379133) has the molecular formula C24H14BrClN2O3S and a molecular weight of 525.81 g/mol. Its IUPAC name is (4E,5R)-1-(6-bromo-1,3-benzothiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-1-(6-bromo-1,3-benzothiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98379133 |
| Molecular Formula | C24H14BrClN2O3S |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 523.96 |
| IUPAC Name | (4E,5R)-1-(6-bromo-1,3-benzothiazol-2-yl)-5-(4-chlorophenyl)-4-[hydroxy(phenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2nc3ccc(Br)cc3s2)[C@H](c2ccc(Cl)cc2)/C1=C(\O)c1ccccc1 |
| InChI | InChI=1S/C24H14BrClN2O3S/c25-15-8-11-17-18(12-15)32-24(27-17)28-20(13-6-9-16(26)10-7-13)19(22(30)23(28)31)21(29)14-4-2-1-3-5-14/h1-12,20,29H/b21-19+/t20-/m1/s1 |
| InChIKey | VFOLQLCHSYQTJW-YDJIHCHBSA-N |
| XLogP | 6.34 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|