C27H20Cl2N2O3S — CID 108714984
(4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714984) has the molecular formula C27H20Cl2N2O3S and a molecular weight of 523.44 g/mol. Its IUPAC name is (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714984 |
| Molecular Formula | C27H20Cl2N2O3S |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(Cl)c(Cl)c4)C3c3cccc(C)c3)sc2c1 |
| InChI | InChI=1S/C27H20Cl2N2O3S/c1-3-15-7-10-20-21(12-15)35-27(30-20)31-23(16-6-4-5-14(2)11-16)22(25(33)26(31)34)24(32)17-8-9-18(28)19(29)13-17/h4-13,23,32H,3H2,1-2H3/b24-22+ |
| InChIKey | BNLJCDNNWWOCFR-ZNTNEXAZSA-N |
| XLogP | 7.10 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|