C31H24N2O3S — CID 108714891
(4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714891) has the molecular formula C31H24N2O3S and a molecular weight of 504.61 g/mol. Its IUPAC name is (4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714891 |
| Molecular Formula | C31H24N2O3S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy(naphthalen-1-yl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(C2/C(=C(\O)c3cccc4ccccc34)C(=O)C(=O)N2c2nc3cc(C)c(C)cc3s2)c1 |
| InChI | InChI=1S/C31H24N2O3S/c1-17-8-6-11-21(14-17)27-26(28(34)23-13-7-10-20-9-4-5-12-22(20)23)29(35)30(36)33(27)31-32-24-15-18(2)19(3)16-25(24)37-31/h4-16,27,34H,1-3H3/b28-26+ |
| InChIKey | AAQSZTHRHRCTAJ-BYCLXTJYSA-N |
| XLogP | 7.00 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|