C30H28N2O4S — CID 108714872
(4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714872) has the molecular formula C30H28N2O4S and a molecular weight of 512.63 g/mol. Its IUPAC name is (4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714872 |
| Molecular Formula | C30H28N2O4S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | (4E)-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1c(C)cc(C)cc1/C(O)=C1\C(=O)C(=O)N(c2nc3cc(C)c(C)cc3s2)C1c1cccc(C)c1 |
| InChI | InChI=1S/C30H28N2O4S/c1-15-8-7-9-20(11-15)25-24(26(33)21-12-16(2)10-19(5)28(21)36-6)27(34)29(35)32(25)30-31-22-13-17(3)18(4)14-23(22)37-30/h7-14,25,33H,1-6H3/b26-24+ |
| InChIKey | ZOKCMECILYNGFO-SHHOIMCASA-N |
| XLogP | 6.47 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|