C29H24Cl2N2O5S — CID 108714930
(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714930) has the molecular formula C29H24Cl2N2O5S and a molecular weight of 583.49 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714930 |
| Molecular Formula | C29H24Cl2N2O5S |
| Molecular Weight | 583.49 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(c3nc4cc(C)c(C)cc4s3)C2c2cccc(C)c2)c(OC)c1Cl |
| InChI | InChI=1S/C29H24Cl2N2O5S/c1-13-7-6-8-16(9-13)23-21(24(34)17-12-18(30)27(38-5)22(31)26(17)37-4)25(35)28(36)33(23)29-32-19-10-14(2)15(3)11-20(19)39-29/h6-12,23,34H,1-5H3/b24-21+ |
| InChIKey | NWDHZHQSHXGLKZ-DARPEHSRSA-N |
| XLogP | 7.17 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.49 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|