C28H20N4O5S2 — CID 98196506
(1S)-7-methyl-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 98196506) has the molecular formula C28H20N4O5S2 and a molecular weight of 556.63 g/mol. Its IUPAC name is (1S)-7-methyl-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1S)-7-methyl-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 98196506 |
| Molecular Formula | C28H20N4O5S2 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.09 |
| IUPAC Name | (1S)-7-methyl-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1ccc(CSc2nnc(N3C(=O)c4oc5ccc(C)cc5c(=O)c4[C@@H]3c3cccc([N+](=O)[O-])c3)s2)cc1 |
| InChI | InChI=1S/C28H20N4O5S2/c1-15-6-9-17(10-7-15)14-38-28-30-29-27(39-28)31-23(18-4-3-5-19(13-18)32(35)36)22-24(33)20-12-16(2)8-11-21(20)37-25(22)26(31)34/h3-13,23H,14H2,1-2H3/t23-/m0/s1 |
| InChIKey | CAQXGYYPPQNJMD-QHCPKHFHSA-N |
| XLogP | 6.21 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|