C28H21N3O4S2 — CID 18819001
2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-hydroxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18819001) has the molecular formula C28H21N3O4S2 and a molecular weight of 527.63 g/mol. Its IUPAC name is 2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-hydroxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-hydroxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18819001 |
| Molecular Formula | C28H21N3O4S2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | 2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(3-hydroxyphenyl)-6,7-dimethyl-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1cc2oc3c(c(=O)c2cc1C)C(c1cccc(O)c1)N(c1nnc(SCc2ccccc2)s1)C3=O |
| InChI | InChI=1S/C28H21N3O4S2/c1-15-11-20-21(12-16(15)2)35-25-22(24(20)33)23(18-9-6-10-19(32)13-18)31(26(25)34)27-29-30-28(37-27)36-14-17-7-4-3-5-8-17/h3-13,23,32H,14H2,1-2H3 |
| InChIKey | RPCMCNJLNMNBQM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|