C28H19N3O5S2 — CID 18818334
methyl 4-[2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate (PubChem CID 18818334) has the molecular formula C28H19N3O5S2 and a molecular weight of 541.61 g/mol. Its IUPAC name is methyl 4-[2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 18818334 |
| Molecular Formula | C28H19N3O5S2 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | methyl 4-[2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-3,9-dioxo-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2c3c(oc4ccccc4c3=O)C(=O)N2c2nnc(SCc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C28H19N3O5S2/c1-35-26(34)18-13-11-17(12-14-18)22-21-23(32)19-9-5-6-10-20(19)36-24(21)25(33)31(22)27-29-30-28(38-27)37-15-16-7-3-2-4-8-16/h2-14,22H,15H2,1H3 |
| InChIKey | SAZRQFIZILAKLX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|