C29H23N3O4S2 — CID 18818355
1-(3-ethoxyphenyl)-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18818355) has the molecular formula C29H23N3O4S2 and a molecular weight of 541.65 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-ethoxyphenyl)-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18818355 |
| Molecular Formula | C29H23N3O4S2 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | 1-(3-ethoxyphenyl)-2-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOc1cccc(C2c3c(oc4ccccc4c3=O)C(=O)N2c2nnc(SCc3ccc(C)cc3)s2)c1 |
| InChI | InChI=1S/C29H23N3O4S2/c1-3-35-20-8-6-7-19(15-20)24-23-25(33)21-9-4-5-10-22(21)36-26(23)27(34)32(24)28-30-31-29(38-28)37-16-18-13-11-17(2)12-14-18/h4-15,24H,3,16H2,1-2H3 |
| InChIKey | UJPUEGHFGPKRMD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|