C26H15F2N3O3S2 — CID 18819019
2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(2-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 18819019) has the molecular formula C26H15F2N3O3S2 and a molecular weight of 519.55 g/mol. Its IUPAC name is 2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(2-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(2-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 18819019 |
| Molecular Formula | C26H15F2N3O3S2 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 2-(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)-7-fluoro-1-(2-fluorophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccc(F)cc3c(=O)c2C(c2ccccc2F)N1c1nnc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C26H15F2N3O3S2/c27-15-10-11-19-17(12-15)22(32)20-21(16-8-4-5-9-18(16)28)31(24(33)23(20)34-19)25-29-30-26(36-25)35-13-14-6-2-1-3-7-14/h1-12,21H,13H2 |
| InChIKey | OMBCWDXVIVLBEK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|