C19H9BrN4O5S — CID 4706934
7-bromo-1-(3-nitrophenyl)-2-(1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4706934) has the molecular formula C19H9BrN4O5S and a molecular weight of 485.28 g/mol. Its IUPAC name is 7-bromo-1-(3-nitrophenyl)-2-(1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-nitrophenyl)-2-(1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4706934 |
| Molecular Formula | C19H9BrN4O5S |
| Molecular Weight | 485.28 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | 7-bromo-1-(3-nitrophenyl)-2-(1,3,4-thiadiazol-2-yl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1c2oc3ccc(Br)cc3c(=O)c2C(c2cccc([N+](=O)[O-])c2)N1c1nncs1 |
| InChI | InChI=1S/C19H9BrN4O5S/c20-10-4-5-13-12(7-10)16(25)14-15(9-2-1-3-11(6-9)24(27)28)23(18(26)17(14)29-13)19-22-21-8-30-19/h1-8,15H |
| InChIKey | NGRLLCDGWFWTKH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 119.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|