C23H16BrN3O5 — CID 34821228
(1R)-7-bromo-2-[(2S)-2-methyl-1,2-dihydropyridin-6-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 34821228) has the molecular formula C23H16BrN3O5 and a molecular weight of 494.30 g/mol. Its IUPAC name is (1R)-7-bromo-2-[(2S)-2-methyl-1,2-dihydropyridin-6-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-7-bromo-2-[(2S)-2-methyl-1,2-dihydropyridin-6-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 34821228 |
| Molecular Formula | C23H16BrN3O5 |
| Molecular Weight | 494.30 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | (1R)-7-bromo-2-[(2S)-2-methyl-1,2-dihydropyridin-6-yl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | C[C@H]1C=CC=C(N2C(=O)c3oc4ccc(Br)cc4c(=O)c3[C@H]2c2cccc([N+](=O)[O-])c2)N1 |
| InChI | InChI=1S/C23H16BrN3O5/c1-12-4-2-7-18(25-12)26-20(13-5-3-6-15(10-13)27(30)31)19-21(28)16-11-14(24)8-9-17(16)32-22(19)23(26)29/h2-12,20,25H,1H3/t12-,20+/m0/s1 |
| InChIKey | XWBIOHAPXYUADL-FKIZINRSSA-N |
| XLogP | 4.40 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|