C23H21BrN2O6 — CID 2963596
7-bromo-1-(3-nitrophenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 2963596) has the molecular formula C23H21BrN2O6 and a molecular weight of 501.33 g/mol. Its IUPAC name is 7-bromo-1-(3-nitrophenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(3-nitrophenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 2963596 |
| Molecular Formula | C23H21BrN2O6 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 7-bromo-1-(3-nitrophenyl)-2-(3-propan-2-yloxypropyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CC(C)OCCCN1C(=O)c2oc3ccc(Br)cc3c(=O)c2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21BrN2O6/c1-13(2)31-10-4-9-25-20(14-5-3-6-16(11-14)26(29)30)19-21(27)17-12-15(24)7-8-18(17)32-22(19)23(25)28/h3,5-8,11-13,20H,4,9-10H2,1-2H3 |
| InChIKey | ACUGNLOFIISBTK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|