C22H20ClN3O5 — CID 40837577
(1R)-7-chloro-2-[3-(dimethylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 40837577) has the molecular formula C22H20ClN3O5 and a molecular weight of 441.87 g/mol. Its IUPAC name is (1R)-7-chloro-2-[3-(dimethylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1R)-7-chloro-2-[3-(dimethylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 40837577 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (1R)-7-chloro-2-[3-(dimethylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CN(C)CCCN1C(=O)c2oc3ccc(Cl)cc3c(=O)c2[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20ClN3O5/c1-24(2)9-4-10-25-19(13-5-3-6-15(11-13)26(29)30)18-20(27)16-12-14(23)7-8-17(16)31-21(18)22(25)28/h3,5-8,11-12,19H,4,9-10H2,1-2H3/t19-/m1/s1 |
| InChIKey | UYJMLOFRIIKCKI-LJQANCHMSA-N |
| XLogP | 3.85 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|