C28H33N3O5 — CID 4702798
2-[3-(dibutylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 4702798) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[3-(dibutylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-[3-(dibutylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 4702798 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-[3-(dibutylamino)propyl]-1-(3-nitrophenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCN(CCCC)CCCN1C(=O)c2oc3ccccc3c(=O)c2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H33N3O5/c1-3-5-15-29(16-6-4-2)17-10-18-30-25(20-11-9-12-21(19-20)31(34)35)24-26(32)22-13-7-8-14-23(22)36-27(24)28(30)33/h7-9,11-14,19,25H,3-6,10,15-18H2,1-2H3 |
| InChIKey | DDADGJSMDZABCW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 96.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|